C21H37N5S — CID 109470158
1-[(1-ethylcyclobutyl)methyl]-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-methylguanidine (PubChem CID 109470158) has the molecular formula C21H37N5S and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-[(1-ethylcyclobutyl)methyl]-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[(1-ethylcyclobutyl)methyl]-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109470158 |
| Molecular Formula | C21H37N5S |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-[(1-ethylcyclobutyl)methyl]-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-methylguanidine |
| SMILES | CCc1nc(CN2CCC(CN/C(=N/C)NCC3(CC)CCC3)CC2)cs1 |
| InChI | InChI=1S/C21H37N5S/c1-4-19-25-18(15-27-19)14-26-11-7-17(8-12-26)13-23-20(22-3)24-16-21(5-2)9-6-10-21/h15,17H,4-14,16H2,1-3H3,(H2,22,23,24) |
| InChIKey | VTDIBUMWFLFYQR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|