C21H29IN6S — CID 111826720
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111826720) has the molecular formula C21H29IN6S and a molecular weight of 524.48 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111826720 |
| Molecular Formula | C21H29IN6S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(N2CCCC2)n1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C21H28N6S.HI/c1-22-20(23-10-8-16-14-25-19-7-3-2-6-18(16)19)24-11-9-17-15-28-21(26-17)27-12-4-5-13-27;/h2-3,6-7,14-15,25H,4-5,8-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | HXOUZMZMVSSIIU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|