C18H20F3N5S — CID 111688990
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111688990) has the molecular formula C18H20F3N5S and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111688990 |
| Molecular Formula | C18H20F3N5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20F3N5S/c1-22-17(24-9-7-16-26-15(11-27-16)18(19,20)21)23-8-6-12-10-25-14-5-3-2-4-13(12)14/h2-5,10-11,25H,6-9H2,1H3,(H2,22,23,24) |
| InChIKey | RNXPDLSCDMBYPU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|