C18H22F3N5OS — CID 111687998
N-benzyl-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide (PubChem CID 111687998) has the molecular formula C18H22F3N5OS and a molecular weight of 413.47 g/mol. Its IUPAC name is N-benzyl-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-benzyl-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111687998 |
| Molecular Formula | C18H22F3N5OS |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-benzyl-3-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)NCc1ccccc1)NCCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H22F3N5OS/c1-22-17(24-10-8-16-26-14(12-28-16)18(19,20)21)23-9-7-15(27)25-11-13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3,(H,25,27)(H2,22,23,24) |
| InChIKey | LJKXGQLQNSYHMR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|