C23H32IN5S — CID 110995684
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 110995684) has the molecular formula C23H32IN5S and a molecular weight of 537.52 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110995684 |
| Molecular Formula | C23H32IN5S |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCC1CCN(Cc2cccs2)CC1.I |
| InChI | InChI=1S/C23H31N5S.HI/c1-24-23(25-11-8-19-16-26-22-7-3-2-6-21(19)22)27-15-18-9-12-28(13-10-18)17-20-5-4-14-29-20;/h2-7,14,16,18,26H,8-13,15,17H2,1H3,(H2,24,25,27);1H |
| InChIKey | SFQURSGQHILQSR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|