C19H29IN4S2 — CID 111892674
2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111892674) has the molecular formula C19H29IN4S2 and a molecular weight of 504.51 g/mol. Its IUPAC name is 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111892674 |
| Molecular Formula | C19H29IN4S2 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1sccc1C)NCC1CCN(Cc2cccs2)CC1.I |
| InChI | InChI=1S/C19H28N4S2.HI/c1-15-7-11-25-18(15)13-22-19(20-2)21-12-16-5-8-23(9-6-16)14-17-4-3-10-24-17;/h3-4,7,10-11,16H,5-6,8-9,12-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | KQRSKJGOOPISBG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|