C20H30N4S2 — CID 111893703
1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111893703) has the molecular formula C20H30N4S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111893703 |
| Molecular Formula | C20H30N4S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1sccc1C)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H30N4S2/c1-3-21-20(23-14-19-16(2)8-12-26-19)22-13-17-6-9-24(10-7-17)15-18-5-4-11-25-18/h4-5,8,11-12,17H,3,6-7,9-10,13-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | NETODALABULMDN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|