C22H33IN4OS — CID 111250268
1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111250268) has the molecular formula C22H33IN4OS and a molecular weight of 528.50 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111250268 |
| Molecular Formula | C22H33IN4OS |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)NCC1CCN(Cc2cccs2)CC1.I |
| InChI | InChI=1S/C22H32N4OS.HI/c1-3-23-22(25-16-19-6-4-7-20(14-19)27-2)24-15-18-9-11-26(12-10-18)17-21-8-5-13-28-21;/h4-8,13-14,18H,3,9-12,15-17H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | QEPJBEZYKUMMQK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|