C20H31IN4S2 — CID 111893704
1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111893704) has the molecular formula C20H31IN4S2 and a molecular weight of 518.53 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893704 |
| Molecular Formula | C20H31IN4S2 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 1-ethyl-2-[(3-methylthiophen-2-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sccc1C)NCC1CCCN(Cc2cccs2)C1.I |
| InChI | InChI=1S/C20H30N4S2.HI/c1-3-21-20(23-13-19-16(2)8-11-26-19)22-12-17-6-4-9-24(14-17)15-18-7-5-10-25-18;/h5,7-8,10-11,17H,3-4,6,9,12-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | NIRZSWABYXPCSW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|