C20H27ClN4S — CID 111174765
1-[(2-chlorophenyl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111174765) has the molecular formula C20H27ClN4S and a molecular weight of 390.98 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111174765 |
| Molecular Formula | C20H27ClN4S |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1Cl)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H27ClN4S/c1-22-20(24-14-17-5-2-3-7-19(17)21)23-13-16-8-10-25(11-9-16)15-18-6-4-12-26-18/h2-7,12,16H,8-11,13-15H2,1H3,(H2,22,23,24) |
| InChIKey | NBVDIYQAEPKHKE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|