C23H30IN5OS — CID 111553710
2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111553710) has the molecular formula C23H30IN5OS and a molecular weight of 551.50 g/mol. Its IUPAC name is 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553710 |
| Molecular Formula | C23H30IN5OS |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCC1CCN(Cc2cccs2)CC1.I |
| InChI | InChI=1S/C23H29N5OS.HI/c1-24-23(26-15-20-17-29-22(27-20)19-6-3-2-4-7-19)25-14-18-9-11-28(12-10-18)16-21-8-5-13-30-21;/h2-8,13,17-18H,9-12,14-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | GTXIXBMJRBGSHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|