C20H37IN4OS — CID 111240706
1-(3-butoxypropyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111240706) has the molecular formula C20H37IN4OS and a molecular weight of 508.51 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111240706 |
| Molecular Formula | C20H37IN4OS |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\C)NCC1CCN(Cc2cccs2)CC1.I |
| InChI | InChI=1S/C20H36N4OS.HI/c1-3-4-13-25-14-6-10-22-20(21-2)23-16-18-8-11-24(12-9-18)17-19-7-5-15-26-19;/h5,7,15,18H,3-4,6,8-14,16-17H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | KSYNLRVPZDEORJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|