C24H38IN5OS — CID 111761528
1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111761528) has the molecular formula C24H38IN5OS and a molecular weight of 571.57 g/mol. Its IUPAC name is 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111761528 |
| Molecular Formula | C24H38IN5OS |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(Cc2csc(CC)n2)CC1)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H37N5OS.HI/c1-4-23-28-21(18-31-23)17-29-14-11-20(12-15-29)16-27-24(25-5-2)26-13-10-19-6-8-22(30-3)9-7-19;/h6-9,18,20H,4-5,10-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | YIKCUKUQVWGNBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|