C18H33N5OS — CID 111758516
1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-(2-methoxyethyl)guanidine (PubChem CID 111758516) has the molecular formula C18H33N5OS and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 111758516 |
| Molecular Formula | C18H33N5OS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-ethyl-2-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-(2-methoxyethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(Cc2csc(CC)n2)CC1)NCCOC |
| InChI | InChI=1S/C18H33N5OS/c1-4-17-22-16(14-25-17)13-23-9-6-15(7-10-23)12-21-18(19-5-2)20-8-11-24-3/h14-15H,4-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | APEZSDVQONGHBI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|