C20H34N4O2S — CID 95560997
(3R)-1-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 95560997) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is (3R)-1-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95560997 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (3R)-1-[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | CCc1nc(CN2CCC(N3CCC[C@@H](C(=O)NCCOC)C3)CC2)cs1 |
| InChI | InChI=1S/C20H34N4O2S/c1-3-19-22-17(15-27-19)14-23-10-6-18(7-11-23)24-9-4-5-16(13-24)20(25)21-8-12-26-2/h15-16,18H,3-14H2,1-2H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | WLZVVJSMPYKUNG-MRXNPFEDSA-N |
| XLogP | 2.14 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|