C23H33N3O3 — CID 95202895
(3R)-1-[1-(1-benzofuran-5-ylmethyl)piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 95202895) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is (3R)-1-[1-(1-benzofuran-5-ylmethyl)piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(1-benzofuran-5-ylmethyl)piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95202895 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | (3R)-1-[1-(1-benzofuran-5-ylmethyl)piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCN(C2CCN(Cc3ccc4occc4c3)CC2)C1 |
| InChI | InChI=1S/C23H33N3O3/c1-28-14-9-24-23(27)20-3-2-10-26(17-20)21-6-11-25(12-7-21)16-18-4-5-22-19(15-18)8-13-29-22/h4-5,8,13,15,20-21H,2-3,6-7,9-12,14,16-17H2,1H3,(H,24,27)/t20-/m1/s1 |
| InChIKey | QGRBKPQYCNRLTM-HXUWFJFHSA-N |
| XLogP | 2.87 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|