C19H30ClN3O2S — CID 95206919
(3S)-1-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 95206919) has the molecular formula C19H30ClN3O2S and a molecular weight of 399.99 g/mol. Its IUPAC name is (3S)-1-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95206919 |
| Molecular Formula | C19H30ClN3O2S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (3S)-1-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CCCN(C2CCN(Cc3ccc(Cl)s3)CC2)C1 |
| InChI | InChI=1S/C19H30ClN3O2S/c1-25-12-8-21-19(24)15-3-2-9-23(13-15)16-6-10-22(11-7-16)14-17-4-5-18(20)26-17/h4-5,15-16H,2-3,6-14H2,1H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | ZWXNLLXSRQFKFP-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|