C21H32FN3O2 — CID 56758609
1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 56758609) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is 1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56758609 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(C2CCN(Cc3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C21H32FN3O2/c1-27-14-10-23-21(26)18-6-4-11-25(16-18)19-8-12-24(13-9-19)15-17-5-2-3-7-20(17)22/h2-3,5,7,18-19H,4,6,8-16H2,1H3,(H,23,26) |
| InChIKey | ATWHDCDGXOUBIJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|