C20H35N5O2 — CID 56745532
1-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 56745532) has the molecular formula C20H35N5O2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56745532 |
| Molecular Formula | C20H35N5O2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 1-[1-[(1,3-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(C2CCN(Cc3cn(C)nc3C)CC2)C1 |
| InChI | InChI=1S/C20H35N5O2/c1-16-18(13-23(2)22-16)14-24-10-6-19(7-11-24)25-9-4-5-17(15-25)20(26)21-8-12-27-3/h13,17,19H,4-12,14-15H2,1-3H3,(H,21,26) |
| InChIKey | FIHNJJKXDXYSHW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|