C24H38F2IN5O — CID 111003268
1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111003268) has the molecular formula C24H38F2IN5O and a molecular weight of 577.50 g/mol. Its IUPAC name is 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111003268 |
| Molecular Formula | C24H38F2IN5O |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2ccc(F)c(F)c2)C1)NCC1(N2CCOCC2)CCCCC1.I |
| InChI | InChI=1S/C24H37F2N5O.HI/c1-27-23(29-18-24(8-3-2-4-9-24)31-11-13-32-14-12-31)28-16-19-7-10-30(17-19)20-5-6-21(25)22(26)15-20;/h5-6,15,19H,2-4,7-14,16-18H2,1H3,(H2,27,28,29);1H |
| InChIKey | DMJGGJGMCFISJK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|