C22H43N5O — CID 111003367
2-methyl-1-[(1-morpholin-4-ylcyclohexyl)methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 111003367) has the molecular formula C22H43N5O and a molecular weight of 393.62 g/mol. Its IUPAC name is 2-methyl-1-[(1-morpholin-4-ylcyclohexyl)methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-morpholin-4-ylcyclohexyl)methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111003367 |
| Molecular Formula | C22H43N5O |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.35 |
| IUPAC Name | 2-methyl-1-[(1-morpholin-4-ylcyclohexyl)methyl]-3-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CCCN(C(C)C)C1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H43N5O/c1-19(2)26-11-7-8-20(17-26)16-24-21(23-3)25-18-22(9-5-4-6-10-22)27-12-14-28-15-13-27/h19-20H,4-18H2,1-3H3,(H2,23,24,25) |
| InChIKey | BQZHUEVQEMVPMJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|