C20H40N6O — CID 111826885
1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111826885) has the molecular formula C20H40N6O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111826885 |
| Molecular Formula | C20H40N6O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CN(C)CCN1C)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H40N6O/c1-21-19(22-15-18-16-24(2)9-10-25(18)3)23-17-20(7-5-4-6-8-20)26-11-13-27-14-12-26/h18H,4-17H2,1-3H3,(H2,21,22,23) |
| InChIKey | OWVFVPRYBOACNT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|