C19H37N5O3S — CID 111004217
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111004217) has the molecular formula C19H37N5O3S and a molecular weight of 415.60 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111004217 |
| Molecular Formula | C19H37N5O3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCCN1CCS(=O)(=O)CC1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H37N5O3S/c1-20-18(21-7-8-23-11-15-28(25,26)16-12-23)22-17-19(5-3-2-4-6-19)24-9-13-27-14-10-24/h2-17H2,1H3,(H2,20,21,22) |
| InChIKey | XMQNOYZPEWSJGL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|