C17H32N4O3S — CID 111140323
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111140323) has the molecular formula C17H32N4O3S and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111140323 |
| Molecular Formula | C17H32N4O3S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(N2CCOCC2)CCCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H32N4O3S/c1-18-16(20-15-5-12-25(22,23)13-15)19-14-17(6-3-2-4-7-17)21-8-10-24-11-9-21/h15H,2-14H2,1H3,(H2,18,19,20) |
| InChIKey | POXMQXAWGJNDJA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|