C25H48N6O — CID 111497225
2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111497225) has the molecular formula C25H48N6O and a molecular weight of 448.70 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111497225 |
| Molecular Formula | C25H48N6O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 2-methyl-1-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | C/N=C(\NCC1(N2CCOCC2)CCCCC1)NCC1(N2CCCCC2)CCN(C)CC1 |
| InChI | InChI=1S/C25H48N6O/c1-26-23(27-21-24(9-5-3-6-10-24)31-17-19-32-20-18-31)28-22-25(11-15-29(2)16-12-25)30-13-7-4-8-14-30/h3-22H2,1-2H3,(H2,26,27,28) |
| InChIKey | FWQYIUUZPZVMEM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|