C19H36N4O3 — CID 111003577
ethyl 4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanoate (PubChem CID 111003577) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111003577 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H36N4O3/c1-3-26-17(24)8-7-11-21-18(20-2)22-16-19(9-5-4-6-10-19)23-12-14-25-15-13-23/h3-16H2,1-2H3,(H2,20,21,22) |
| InChIKey | BVIRPIANNJBGNE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|