C24H38IN5O — CID 111771475
1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111771475) has the molecular formula C24H38IN5O and a molecular weight of 539.51 g/mol. Its IUPAC name is 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111771475 |
| Molecular Formula | C24H38IN5O |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(N2CC=CC2)c1)NCC1(N2CCOCC2)CCCCC1.I |
| InChI | InChI=1S/C24H37N5O.HI/c1-25-23(26-19-21-8-7-9-22(18-21)28-12-5-6-13-28)27-20-24(10-3-2-4-11-24)29-14-16-30-17-15-29;/h5-9,18H,2-4,10-17,19-20H2,1H3,(H2,25,26,27);1H |
| InChIKey | KXKYOCFADUWFKL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|