C25H39N5O — CID 111771472
2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111771472) has the molecular formula C25H39N5O and a molecular weight of 425.62 g/mol. Its IUPAC name is 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111771472 |
| Molecular Formula | C25H39N5O |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.32 |
| IUPAC Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(1-morpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(N2CC=CC2)c1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C25H39N5O/c1-2-26-24(27-20-22-9-8-10-23(19-22)29-13-6-7-14-29)28-21-25(11-4-3-5-12-25)30-15-17-31-18-16-30/h6-10,19H,2-5,11-18,20-21H2,1H3,(H2,26,27,28) |
| InChIKey | HDLZLELVXPJFQC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|