C19H30N4 — CID 111772088
2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-pentylguanidine (PubChem CID 111772088) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-pentylguanidine.
| Compound Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-pentylguanidine |
|---|---|
| PubChem CID | 111772088 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N/Cc1cccc(N2CC=CC2)c1)NCC |
| InChI | InChI=1S/C19H30N4/c1-3-5-6-12-21-19(20-4-2)22-16-17-10-9-11-18(15-17)23-13-7-8-14-23/h7-11,15H,3-6,12-14,16H2,1-2H3,(H2,20,21,22) |
| InChIKey | XSMWJTHUYRUEQB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|