C22H29IN4 — CID 111774029
2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111774029) has the molecular formula C22H29IN4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111774029 |
| Molecular Formula | C22H29IN4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N2CC=CC2)c1)NCc1ccc(C)cc1.I |
| InChI | InChI=1S/C22H28N4.HI/c1-3-23-22(24-16-19-11-9-18(2)10-12-19)25-17-20-7-6-8-21(15-20)26-13-4-5-14-26;/h4-12,15H,3,13-14,16-17H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | YUVMDJBSFQLGAS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|