C20H24N4 — CID 111770604
1-benzyl-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine (PubChem CID 111770604) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-benzyl-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-benzyl-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111770604 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-benzyl-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccccc1)NCc1cccc(N2CC=CC2)c1 |
| InChI | InChI=1S/C20H24N4/c1-21-20(22-15-17-8-3-2-4-9-17)23-16-18-10-7-11-19(14-18)24-12-5-6-13-24/h2-11,14H,12-13,15-16H2,1H3,(H2,21,22,23) |
| InChIKey | PCFMHDPPWCBLMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|