C21H26ClIN4 — CID 111775647
1-[2-(3-chlorophenyl)ethyl]-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111775647) has the molecular formula C21H26ClIN4 and a molecular weight of 496.82 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111775647 |
| Molecular Formula | C21H26ClIN4 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1cccc(N2CC=CC2)c1.I |
| InChI | InChI=1S/C21H25ClN4.HI/c1-23-21(24-11-10-17-6-4-8-19(22)14-17)25-16-18-7-5-9-20(15-18)26-12-2-3-13-26;/h2-9,14-15H,10-13,16H2,1H3,(H2,23,24,25);1H |
| InChIKey | NONXIOZRNIFNGB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|