C21H26F3IN4 — CID 111853277
1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111853277) has the molecular formula C21H26F3IN4 and a molecular weight of 518.37 g/mol. Its IUPAC name is 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111853277 |
| Molecular Formula | C21H26F3IN4 |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(F)c(C)c1)NCC1CCN(c2ccc(F)c(F)c2)C1.I |
| InChI | InChI=1S/C21H25F3N4.HI/c1-14-9-15(3-5-18(14)22)11-26-21(25-2)27-12-16-7-8-28(13-16)17-4-6-19(23)20(24)10-17;/h3-6,9-10,16H,7-8,11-13H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | HUKLXCUIWUEOKZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|