C21H35F2IN4O2 — CID 111693487
1-[2-(2-butoxyethoxy)ethyl]-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111693487) has the molecular formula C21H35F2IN4O2 and a molecular weight of 540.44 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111693487 |
| Molecular Formula | C21H35F2IN4O2 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)NCC1CCN(c2ccc(F)c(F)c2)C1.I |
| InChI | InChI=1S/C21H34F2N4O2.HI/c1-3-4-10-28-12-13-29-11-8-25-21(24-2)26-15-17-7-9-27(16-17)18-5-6-19(22)20(23)14-18;/h5-6,14,17H,3-4,7-13,15-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | QFNDNTKEQOUMRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|