C20H34BrIN4O — CID 111402326
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 111402326) has the molecular formula C20H34BrIN4O and a molecular weight of 553.33 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111402326 |
| Molecular Formula | C20H34BrIN4O |
| Molecular Weight | 553.33 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(C)C)NCC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C20H33BrN4O.HI/c1-16(2)15-26-12-4-10-23-20(22-3)24-13-17-9-11-25(14-17)19-7-5-18(21)6-8-19;/h5-8,16-17H,4,9-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | ZIESVCFYRGUCQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|