C20H26BrN5 — CID 111192134
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192134) has the molecular formula C20H26BrN5 and a molecular weight of 416.37 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192134 |
| Molecular Formula | C20H26BrN5 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)NCC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H26BrN5/c1-22-20(24-12-9-18-4-2-3-11-23-18)25-14-16-10-13-26(15-16)19-7-5-17(21)6-8-19/h2-8,11,16H,9-10,12-15H2,1H3,(H2,22,24,25) |
| InChIKey | RJJCGVWMRAXXMQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|