C21H30IN5O — CID 111191233
1-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111191233) has the molecular formula C21H30IN5O and a molecular weight of 495.41 g/mol. Its IUPAC name is 1-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111191233 |
| Molecular Formula | C21H30IN5O |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)NCC1CCN(c2ccccc2OC)C1.I |
| InChI | InChI=1S/C21H29N5O.HI/c1-22-21(24-13-10-18-7-5-6-12-23-18)25-15-17-11-14-26(16-17)19-8-3-4-9-20(19)27-2;/h3-9,12,17H,10-11,13-16H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | IVNZHXHSYFRBAF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|