C18H28BrIN4 — CID 110992840
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide (PubChem CID 110992840) has the molecular formula C18H28BrIN4 and a molecular weight of 507.26 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110992840 |
| Molecular Formula | C18H28BrIN4 |
| Molecular Weight | 507.26 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2ccc(Br)cc2)C1)NC1CCCC1.I |
| InChI | InChI=1S/C18H27BrN4.HI/c1-20-18(22-16-4-2-3-5-16)21-12-14-10-11-23(13-14)17-8-6-15(19)7-9-17;/h6-9,14,16H,2-5,10-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | MZMZCDHXVUMQQK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|