C18H23BrN4O — CID 119151151
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-(furan-3-ylmethyl)-2-methylguanidine (PubChem CID 119151151) has the molecular formula C18H23BrN4O and a molecular weight of 391.31 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-(furan-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-(furan-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 119151151 |
| Molecular Formula | C18H23BrN4O |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-3-(furan-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccoc1)NCC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H23BrN4O/c1-20-18(22-11-15-7-9-24-13-15)21-10-14-6-8-23(12-14)17-4-2-16(19)3-5-17/h2-5,7,9,13-14H,6,8,10-12H2,1H3,(H2,20,21,22) |
| InChIKey | RMWPAPJBKUJUFD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|