C19H31BrIN5O — CID 111076763
1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111076763) has the molecular formula C19H31BrIN5O and a molecular weight of 552.30 g/mol. Its IUPAC name is 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076763 |
| Molecular Formula | C19H31BrIN5O |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 1-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCOCC1)NCC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C19H30BrN5O.HI/c1-21-19(22-7-9-24-10-12-26-13-11-24)23-14-16-6-8-25(15-16)18-4-2-17(20)3-5-18;/h2-5,16H,6-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | ODZPIBLCXZETGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|