C19H30BrIN4 — CID 110992842
2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide (PubChem CID 110992842) has the molecular formula C19H30BrIN4 and a molecular weight of 521.29 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110992842 |
| Molecular Formula | C19H30BrIN4 |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(c2ccc(Br)cc2)C1)NC1CCCC1.I |
| InChI | InChI=1S/C19H29BrN4.HI/c1-2-21-19(23-17-5-3-4-6-17)22-13-15-11-12-24(14-15)18-9-7-16(20)8-10-18;/h7-10,15,17H,2-6,11-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | UBLXCTWWGNNTJV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|