C18H28BrIN4O2S — CID 111140512
2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111140512) has the molecular formula C18H28BrIN4O2S and a molecular weight of 571.32 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111140512 |
| Molecular Formula | C18H28BrIN4O2S |
| Molecular Weight | 571.32 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(c2ccc(Br)cc2)C1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H27BrN4O2S.HI/c1-2-20-18(22-16-8-10-26(24,25)13-16)21-11-14-7-9-23(12-14)17-5-3-15(19)4-6-17;/h3-6,14,16H,2,7-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | QUUHHUGJUNILKI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|