C16H26BrIN4 — CID 110926516
2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1,3-diethylguanidine;hydroiodide (PubChem CID 110926516) has the molecular formula C16H26BrIN4 and a molecular weight of 481.22 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1,3-diethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1,3-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110926516 |
| Molecular Formula | C16H26BrIN4 |
| Molecular Weight | 481.22 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1,3-diethylguanidine;hydroiodide |
| SMILES | CCNC(=NCC1CCN(c2ccc(Br)cc2)C1)NCC.I |
| InChI | InChI=1S/C16H25BrN4.HI/c1-3-18-16(19-4-2)20-11-13-9-10-21(12-13)15-7-5-14(17)6-8-15;/h5-8,13H,3-4,9-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | UARKJRZSBUUMHE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|