C17H28BrIN4 — CID 111076705
2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111076705) has the molecular formula C17H28BrIN4 and a molecular weight of 495.25 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076705 |
| Molecular Formula | C17H28BrIN4 |
| Molecular Weight | 495.25 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | CC(C)CCN/C(N)=N/CC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C17H27BrN4.HI/c1-13(2)7-9-20-17(19)21-11-14-8-10-22(12-14)16-5-3-15(18)4-6-16;/h3-6,13-14H,7-12H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | XDYZMHZRGAOHNE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|