C18H24BrIN4S — CID 111076729
2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111076729) has the molecular formula C18H24BrIN4S and a molecular weight of 535.29 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076729 |
| Molecular Formula | C18H24BrIN4S |
| Molecular Weight | 535.29 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 2-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-1-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(c2ccc(Br)cc2)C1)NCCc1cccs1 |
| InChI | InChI=1S/C18H23BrN4S.HI/c19-15-3-5-16(6-4-15)23-10-8-14(13-23)12-22-18(20)21-9-7-17-2-1-11-24-17;/h1-6,11,14H,7-10,12-13H2,(H3,20,21,22);1H |
| InChIKey | XDUCTFKWCFFUJP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|