C18H27IN4S2 — CID 111084350
1-(2-thiophen-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111084350) has the molecular formula C18H27IN4S2 and a molecular weight of 490.48 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-thiophen-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111084350 |
| Molecular Formula | C18H27IN4S2 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 1-(2-thiophen-2-ylethyl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCN(Cc2cccs2)C1)NCCc1cccs1 |
| InChI | InChI=1S/C18H26N4S2.HI/c19-18(20-8-7-16-5-2-10-23-16)21-12-15-4-1-9-22(13-15)14-17-6-3-11-24-17;/h2-3,5-6,10-11,15H,1,4,7-9,12-14H2,(H3,19,20,21);1H |
| InChIKey | JHZKTGRFCWWHHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|