C22H30N4S — CID 111721479
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 111721479) has the molecular formula C22H30N4S and a molecular weight of 382.58 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111721479 |
| Molecular Formula | C22H30N4S |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | N/C(=N\CC1CCCN(Cc2cccs2)C1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H30N4S/c23-22(25-21-11-3-8-18-7-1-2-10-20(18)21)24-14-17-6-4-12-26(15-17)16-19-9-5-13-27-19/h3,5,8-9,11,13,17H,1-2,4,6-7,10,12,14-16H2,(H3,23,24,25) |
| InChIKey | KICZMXPUDHQQFG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|