C17H25N3S — CID 119146810
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(thian-4-ylmethyl)guanidine (PubChem CID 119146810) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(thian-4-ylmethyl)guanidine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(thian-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119146810 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-(thian-4-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CCSCC1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H25N3S/c18-17(19-12-13-8-10-21-11-9-13)20-16-7-3-5-14-4-1-2-6-15(14)16/h3,5,7,13H,1-2,4,6,8-12H2,(H3,18,19,20) |
| InChIKey | IIYXHLWJUVERQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|