C17H26IN3O — CID 119142322
2-(oxan-4-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 119142322) has the molecular formula C17H26IN3O and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-(oxan-4-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119142322 |
| Molecular Formula | C17H26IN3O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCOCC1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H25N3O.HI/c18-17(19-12-13-8-10-21-11-9-13)20-16-7-3-5-14-4-1-2-6-15(14)16;/h3,5,7,13H,1-2,4,6,8-12H2,(H3,18,19,20);1H |
| InChIKey | OGSCNKRLADAUHT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|