C19H29IN4 — CID 111721224
2-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111721224) has the molecular formula C19H29IN4 and a molecular weight of 440.37 g/mol. Its IUPAC name is 2-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111721224 |
| Molecular Formula | C19H29IN4 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[(1-cyclopropylpyrrolidin-3-yl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(C2CC2)C1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H28N4.HI/c20-19(21-12-14-10-11-23(13-14)16-8-9-16)22-18-7-3-5-15-4-1-2-6-17(15)18;/h3,5,7,14,16H,1-2,4,6,8-13H2,(H3,20,21,22);1H |
| InChIKey | FEGJEKLIEKEKHM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|